C11H15O4P — CID 66796167
[4-(2-methylphenyl)-4-oxobutan-2-yl]phosphonic acid (PubChem CID 66796167) has the molecular formula C11H15O4P and a molecular weight of 242.21 g/mol. Its IUPAC name is [4-(2-methylphenyl)-4-oxobutan-2-yl]phosphonic acid.
| Compound Name | [4-(2-methylphenyl)-4-oxobutan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 66796167 |
| Molecular Formula | C11H15O4P |
| Molecular Weight | 242.21 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | [4-(2-methylphenyl)-4-oxobutan-2-yl]phosphonic acid |
| SMILES | Cc1ccccc1C(=O)CC(C)P(=O)(O)O |
| InChI | InChI=1S/C11H15O4P/c1-8-5-3-4-6-10(8)11(12)7-9(2)16(13,14)15/h3-6,9H,7H2,1-2H3,(H2,13,14,15) |
| InChIKey | UADFCOVEXWJCCG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|