C11H11F3O2 — CID 53255011
(3R)-4,4,4-trifluoro-3-hydroxy-1-(2-methylphenyl)butan-1-one (PubChem CID 53255011) has the molecular formula C11H11F3O2 and a molecular weight of 232.20 g/mol. Its IUPAC name is (3R)-4,4,4-trifluoro-3-hydroxy-1-(2-methylphenyl)butan-1-one.
| Compound Name | (3R)-4,4,4-trifluoro-3-hydroxy-1-(2-methylphenyl)butan-1-one |
|---|---|
| PubChem CID | 53255011 |
| Molecular Formula | C11H11F3O2 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (3R)-4,4,4-trifluoro-3-hydroxy-1-(2-methylphenyl)butan-1-one |
| SMILES | Cc1ccccc1C(=O)C[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C11H11F3O2/c1-7-4-2-3-5-8(7)9(15)6-10(16)11(12,13)14/h2-5,10,16H,6H2,1H3/t10-/m1/s1 |
| InChIKey | LOGCOYBJHOPWMZ-SNVBAGLBSA-N |
| XLogP | 2.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |