C24H21ClO2 — CID 167435263
2-(4-chlorophenyl)-1,4-bis(2-methylphenyl)butane-1,4-dione (PubChem CID 167435263) has the molecular formula C24H21ClO2 and a molecular weight of 376.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1,4-bis(2-methylphenyl)butane-1,4-dione.
| Compound Name | 2-(4-chlorophenyl)-1,4-bis(2-methylphenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 167435263 |
| Molecular Formula | C24H21ClO2 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-(4-chlorophenyl)-1,4-bis(2-methylphenyl)butane-1,4-dione |
| SMILES | Cc1ccccc1C(=O)CC(C(=O)c1ccccc1C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H21ClO2/c1-16-7-3-5-9-20(16)23(26)15-22(18-11-13-19(25)14-12-18)24(27)21-10-6-4-8-17(21)2/h3-14,22H,15H2,1-2H3 |
| InChIKey | QDOLXQUREWUZNA-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |