About (4-aminopiperidin-4-yl)methanol;ethoxyethane
(4-aminopiperidin-4-yl)methanol;ethoxyethane (PubChem CID 66797451) has the molecular formula C10H24N2O2
and a molecular weight of 204.31 g/mol. Its IUPAC name is (4-aminopiperidin-4-yl)methanol;ethoxyethane.
Molecular Properties
| Compound Name | (4-aminopiperidin-4-yl)methanol;ethoxyethane |
| PubChem CID | 66797451 |
| Molecular Formula | C10H24N2O2 |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.18 |
| IUPAC Name | (4-aminopiperidin-4-yl)methanol;ethoxyethane |
| SMILES | CCOCC.NC1(CO)CCNCC1 |
| InChI | InChI=1S/C6H14N2O.C4H10O/c7-6(5-9)1-3-8-4-2-6;1-3-5-4-2/h8-9H,1-5,7H2;3-4H2,1-2H3 |
| InChIKey | PMMDCMWZCQZUSA-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-aminopiperidin-4-yl)methanol;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminopiperidin-4-yl)methanol;ethoxyethane?
The IUPAC name of (4-aminopiperidin-4-yl)methanol;ethoxyethane (CID 66797451) is (4-aminopiperidin-4-yl)methanol;ethoxyethane.
What is the SMILES notation for (4-aminopiperidin-4-yl)methanol;ethoxyethane?
The canonical SMILES for (4-aminopiperidin-4-yl)methanol;ethoxyethane is CCOCC.NC1(CO)CCNCC1.
What is the InChIKey of (4-aminopiperidin-4-yl)methanol;ethoxyethane?
The InChIKey is PMMDCMWZCQZUSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O.C4H10O/c7-6(5-9)1-3-8-4-2-6;1-3-5-4-2/h8-9H,1-5,7H2;3-4H2,1-2H3.
What are the key properties of (4-aminopiperidin-4-yl)methanol;ethoxyethane?
(4-aminopiperidin-4-yl)methanol;ethoxyethane has a molecular weight of 204.31 g/mol, XLogP of 0.10, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminopiperidin-4-yl)methanol;ethoxyethane is sourced from PubChem (CID 66797451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).