C15H23FN4O2 — CID 66799308
tert-butyl N-[1-(5-fluoropyrimidin-4-yl)piperidin-4-yl]-N-methylcarbamate (PubChem CID 66799308) has the molecular formula C15H23FN4O2 and a molecular weight of 310.37 g/mol. Its IUPAC name is tert-butyl N-[1-(5-fluoropyrimidin-4-yl)piperidin-4-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-(5-fluoropyrimidin-4-yl)piperidin-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 66799308 |
| Molecular Formula | C15H23FN4O2 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | tert-butyl N-[1-(5-fluoropyrimidin-4-yl)piperidin-4-yl]-N-methylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(C)C1CCN(CC1)C2=NC=NC=C2F |
| InChI | InChI=1S/C15H23FN4O2/c1-15(2,3)22-14(21)19(4)11-5-7-20(8-6-11)13-12(16)9-17-10-18-13/h9-11H,5-8H2,1-4H3 |
| InChIKey | YEQPQOITVHHEJT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 58.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | 380 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |