C13H16BrNO4 — CID 66800644
(4-bromo-2,3-dimethoxyphenyl)-morpholin-4-ylmethanone (PubChem CID 66800644) has the molecular formula C13H16BrNO4 and a molecular weight of 330.18 g/mol. Its IUPAC name is (4-bromo-2,3-dimethoxyphenyl)-morpholin-4-ylmethanone.
| Compound Name | (4-bromo-2,3-dimethoxyphenyl)-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 66800644 |
| Molecular Formula | C13H16BrNO4 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | (4-bromo-2,3-dimethoxyphenyl)-morpholin-4-ylmethanone |
| SMILES | COc1c(Br)ccc(C(=O)N2CCOCC2)c1OC |
| InChI | InChI=1S/C13H16BrNO4/c1-17-11-9(3-4-10(14)12(11)18-2)13(16)15-5-7-19-8-6-15/h3-4H,5-8H2,1-2H3 |
| InChIKey | ZLGNEXSPDXLXFP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |