C18H13Cl2N7S — CID 66801280
3,5-dichloro-4-[4-[(6-methylpyrimidin-4-yl)amino]-[1,3]thiazolo[5,4-c]pyridin-2-yl]benzenecarboximidamide (PubChem CID 66801280) has the molecular formula C18H13Cl2N7S and a molecular weight of 430.32 g/mol. Its IUPAC name is 3,5-dichloro-4-[4-[(6-methylpyrimidin-4-yl)amino]-[1,3]thiazolo[5,4-c]pyridin-2-yl]benzenecarboximidamide.
| Compound Name | 3,5-dichloro-4-[4-[(6-methylpyrimidin-4-yl)amino]-[1,3]thiazolo[5,4-c]pyridin-2-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 66801280 |
| Molecular Formula | C18H13Cl2N7S |
| Molecular Weight | 430.32 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | 3,5-dichloro-4-[4-[(6-methylpyrimidin-4-yl)amino]-[1,3]thiazolo[5,4-c]pyridin-2-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(Cl)c(-c2nc3ccnc(Nc4cc(C)ncn4)c3s2)c(Cl)c1 |
| InChI | InChI=1S/C18H13Cl2N7S/c1-8-4-13(25-7-24-8)27-17-15-12(2-3-23-17)26-18(28-15)14-10(19)5-9(16(21)22)6-11(14)20/h2-7H,1H3,(H3,21,22)(H,23,24,25,27) |
| InChIKey | PKMAEEPZJFSPNX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 113.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.32 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|