C18H15ClN6O2S — CID 66804943
3-[[2-(2-chlorophenyl)-5-methyl-6-(sulfinoamino)pyrimidin-4-yl]amino]-1H-indazole (PubChem CID 66804943) has the molecular formula C18H15ClN6O2S and a molecular weight of 414.88 g/mol. Its IUPAC name is 3-[[2-(2-chlorophenyl)-5-methyl-6-(sulfinoamino)pyrimidin-4-yl]amino]-1H-indazole.
| Compound Name | 3-[[2-(2-chlorophenyl)-5-methyl-6-(sulfinoamino)pyrimidin-4-yl]amino]-1H-indazole |
|---|---|
| PubChem CID | 66804943 |
| Molecular Formula | C18H15ClN6O2S |
| Molecular Weight | 414.88 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 3-[[2-(2-chlorophenyl)-5-methyl-6-(sulfinoamino)pyrimidin-4-yl]amino]-1H-indazole |
| SMILES | Cc1c(Nc2n[nH]c3ccccc23)nc(-c2ccccc2Cl)nc1NS(=O)O |
| InChI | InChI=1S/C18H15ClN6O2S/c1-10-15(21-18-12-7-3-5-9-14(12)23-24-18)20-17(22-16(10)25-28(26)27)11-6-2-4-8-13(11)19/h2-9H,1H3,(H,26,27)(H3,20,21,22,23,24,25) |
| InChIKey | FRPDKGHUDRKYHU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.88 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|