C19H17N5O2S — CID 66806225
[4-[(5-methyl-1H-pyrazol-3-yl)amino]-2-phenylquinazolin-7-yl]methanesulfinic acid (PubChem CID 66806225) has the molecular formula C19H17N5O2S and a molecular weight of 379.45 g/mol. Its IUPAC name is [4-[(5-methyl-1H-pyrazol-3-yl)amino]-2-phenylquinazolin-7-yl]methanesulfinic acid.
| Compound Name | [4-[(5-methyl-1H-pyrazol-3-yl)amino]-2-phenylquinazolin-7-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 66806225 |
| Molecular Formula | C19H17N5O2S |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | [4-[(5-methyl-1H-pyrazol-3-yl)amino]-2-phenylquinazolin-7-yl]methanesulfinic acid |
| SMILES | Cc1cc(Nc2nc(-c3ccccc3)nc3cc(CS(=O)O)ccc23)n[nH]1 |
| InChI | InChI=1S/C19H17N5O2S/c1-12-9-17(24-23-12)21-19-15-8-7-13(11-27(25)26)10-16(15)20-18(22-19)14-5-3-2-4-6-14/h2-10H,11H2,1H3,(H,25,26)(H2,20,21,22,23,24) |
| InChIKey | HIQKARALLVGJBM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|