C24H23N7O — CID 175345518
N-[4-[7-(cyclopropylamino)-4-[(5-methyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]phenyl]prop-2-enamide (PubChem CID 175345518) has the molecular formula C24H23N7O and a molecular weight of 425.50 g/mol. Its IUPAC name is N-[4-[7-(cyclopropylamino)-4-[(5-methyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[7-(cyclopropylamino)-4-[(5-methyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 175345518 |
| Molecular Formula | C24H23N7O |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | N-[4-[7-(cyclopropylamino)-4-[(5-methyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(-c2nc(Nc3cc(C)[nH]n3)c3ccc(NC4CC4)cc3n2)cc1 |
| InChI | InChI=1S/C24H23N7O/c1-3-22(32)26-17-6-4-15(5-7-17)23-27-20-13-18(25-16-8-9-16)10-11-19(20)24(29-23)28-21-12-14(2)30-31-21/h3-7,10-13,16,25H,1,8-9H2,2H3,(H,26,32)(H2,27,28,29,30,31) |
| InChIKey | CNTBGOUCQIVXHG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|