C16H18N4O — CID 162526966
N-[2-(3-methyl-2H-indazol-5-yl)-4-pyridinyl]prop-2-enamide;molecular hydrogen (PubChem CID 162526966) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is N-[2-(3-methyl-2H-indazol-5-yl)-4-pyridinyl]prop-2-enamide;molecular hydrogen.
| Compound Name | N-[2-(3-methyl-2H-indazol-5-yl)-4-pyridinyl]prop-2-enamide;molecular hydrogen |
|---|---|
| PubChem CID | 162526966 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-[2-(3-methyl-2H-indazol-5-yl)-4-pyridinyl]prop-2-enamide;molecular hydrogen |
| SMILES | C=CC(=O)Nc1ccnc(-c2ccc3n[nH]c(C)c3c2)c1.[H][H].[H][H] |
| InChI | InChI=1S/C16H14N4O.2H2/c1-3-16(21)18-12-6-7-17-15(9-12)11-4-5-14-13(8-11)10(2)19-20-14;;/h3-9H,1H2,2H3,(H,19,20)(H,17,18,21);2*1H |
| InChIKey | QYTLMVZFKHTENH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|