C14H18FN — CID 66807176
(5R)-8-[(2-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octane (PubChem CID 66807176) has the molecular formula C14H18FN and a molecular weight of 219.30 g/mol. Its IUPAC name is (5R)-8-[(2-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octane.
| Compound Name | (5R)-8-[(2-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 66807176 |
| Molecular Formula | C14H18FN |
| Molecular Weight | 219.30 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | (5R)-8-[(2-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octane |
| SMILES | Fc1ccccc1CN1C2CCC[C@@H]1CC2 |
| InChI | InChI=1S/C14H18FN/c15-14-7-2-1-4-11(14)10-16-12-5-3-6-13(16)9-8-12/h1-2,4,7,12-13H,3,5-6,8-10H2/t12-,13?/m1/s1 |
| InChIKey | DUGSSFZLGMEETE-PZORYLMUSA-N |
| XLogP | 3.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |