C36H43F2N3O8 — CID 66813281
[(3R,4S,5R,6R)-4,5-diacetyloxy-6-[3-[[(2S)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]pyrrolidin-2-yl]methyl]-6-fluoro-2-(4-fluorophenyl)indol-1-yl]oxan-3-yl] acetate (PubChem CID 66813281) has the molecular formula C36H43F2N3O8 and a molecular weight of 683.75 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-4,5-diacetyloxy-6-[3-[[(2S)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]pyrrolidin-2-yl]methyl]-6-fluoro-2-(4-fluorophenyl)indol-1-yl]oxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-[3-[[(2S)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]pyrrolidin-2-yl]methyl]-6-fluoro-2-(4-fluorophenyl)indol-1-yl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 66813281 |
| Molecular Formula | C36H43F2N3O8 |
| Molecular Weight | 683.75 g/mol |
| Exact Mass | 683.30 |
| IUPAC Name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-[3-[[(2S)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]pyrrolidin-2-yl]methyl]-6-fluoro-2-(4-fluorophenyl)indol-1-yl]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)CO[C@H]1n1c(-c2ccc(F)cc2)c(C[C@@H]2CCCN2C(=O)[C@@H](N)C(C)(C)C)c2ccc(F)cc21 |
| InChI | InChI=1S/C36H43F2N3O8/c1-19(42)47-29-18-46-35(32(49-21(3)44)31(29)48-20(2)43)41-28-16-24(38)13-14-26(28)27(30(41)22-9-11-23(37)12-10-22)17-25-8-7-15-40(25)34(45)33(39)36(4,5)6/h9-14,16,25,29,31-33,35H,7-8,15,17-18,39H2,1-6H3/t25-,29+,31-,32+,33+,35+/m0/s1 |
| InChIKey | NOVRYAVMKKCSEM-YLBHTGHNSA-N |
| XLogP | 4.82 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.75 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|