C32H37FN2O9 — CID 71137983
benzyl (2S)-2-[[6-fluoro-1-[(3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]-2,3-dihydroindol-3-yl]methyl]pyrrolidine-1-carboxylate (PubChem CID 71137983) has the molecular formula C32H37FN2O9 and a molecular weight of 612.65 g/mol. Its IUPAC name is benzyl (2S)-2-[[6-fluoro-1-[(3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]-2,3-dihydroindol-3-yl]methyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-[[6-fluoro-1-[(3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]-2,3-dihydroindol-3-yl]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71137983 |
| Molecular Formula | C32H37FN2O9 |
| Molecular Weight | 612.65 g/mol |
| Exact Mass | 612.25 |
| IUPAC Name | benzyl (2S)-2-[[6-fluoro-1-[(3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]-2,3-dihydroindol-3-yl]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)COC(N2CC(C[C@@H]3CCCN3C(=O)OCc3ccccc3)c3ccc(F)cc32)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C32H37FN2O9/c1-19(36)42-28-18-40-31(30(44-21(3)38)29(28)43-20(2)37)35-16-23(26-12-11-24(33)15-27(26)35)14-25-10-7-13-34(25)32(39)41-17-22-8-5-4-6-9-22/h4-6,8-9,11-12,15,23,25,28-31H,7,10,13-14,16-18H2,1-3H3/t23?,25-,28+,29-,30+,31?/m0/s1 |
| InChIKey | RFPNBYFWRWNOIN-XKMLKCKJSA-N |
| XLogP | 4.07 |
| TPSA | 120.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.65 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|