About CID 66813969
CID 66813969 (PubChem CID 66813969) has the molecular formula C21H29BrNO2Si
and a molecular weight of 435.46 g/mol.
Molecular Properties
| Compound Name | CID 66813969 |
| PubChem CID | 66813969 |
| Molecular Formula | C21H29BrNO2Si |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | — |
| SMILES | CC(N)c1ccc(Oc2cccc(C(O[Si](C)C)C(C)(C)C)c2)c(Br)c1 |
| InChI | InChI=1S/C21H29BrNO2Si/c1-14(23)15-10-11-19(18(22)13-15)24-17-9-7-8-16(12-17)20(21(2,3)4)25-26(5)6/h7-14,20H,23H2,1-6H3 |
| InChIKey | CVNLGAPDRROFEN-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 66813969 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66813969?
The IUPAC name of CID 66813969 (CID 66813969) is not available.
What is the SMILES notation for CID 66813969?
The canonical SMILES for CID 66813969 is CC(N)c1ccc(Oc2cccc(C(O[Si](C)C)C(C)(C)C)c2)c(Br)c1.
What is the InChIKey of CID 66813969?
The InChIKey is CVNLGAPDRROFEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29BrNO2Si/c1-14(23)15-10-11-19(18(22)13-15)24-17-9-7-8-16(12-17)20(21(2,3)4)25-26(5)6/h7-14,20H,23H2,1-6H3.
What are the key properties of CID 66813969?
CID 66813969 has a molecular weight of 435.46 g/mol, XLogP of 6.62, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66813969 is sourced from PubChem (CID 66813969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).