C24H24F3N3O — CID 66815439
4-(cyclohexylmethylamino)-N-[7-(trifluoromethyl)quinolin-3-yl]benzamide (PubChem CID 66815439) has the molecular formula C24H24F3N3O and a molecular weight of 427.47 g/mol. Its IUPAC name is 4-(cyclohexylmethylamino)-N-[7-(trifluoromethyl)quinolin-3-yl]benzamide.
| Compound Name | 4-(cyclohexylmethylamino)-N-[7-(trifluoromethyl)quinolin-3-yl]benzamide |
|---|---|
| PubChem CID | 66815439 |
| Molecular Formula | C24H24F3N3O |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 4-(cyclohexylmethylamino)-N-[7-(trifluoromethyl)quinolin-3-yl]benzamide |
| SMILES | O=C(Nc1cnc2cc(C(F)(F)F)ccc2c1)c1ccc(NCC2CCCCC2)cc1 |
| InChI | InChI=1S/C24H24F3N3O/c25-24(26,27)19-9-6-18-12-21(15-29-22(18)13-19)30-23(31)17-7-10-20(11-8-17)28-14-16-4-2-1-3-5-16/h6-13,15-16,28H,1-5,14H2,(H,30,31) |
| InChIKey | ZISICXMOXOMMTI-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |