C27H33N3O — CID 66815493
4-[3,7-dimethyloct-6-enyl(methyl)amino]-N-quinolin-3-ylbenzamide (PubChem CID 66815493) has the molecular formula C27H33N3O and a molecular weight of 415.58 g/mol. Its IUPAC name is 4-[3,7-dimethyloct-6-enyl(methyl)amino]-N-quinolin-3-ylbenzamide.
| Compound Name | 4-[3,7-dimethyloct-6-enyl(methyl)amino]-N-quinolin-3-ylbenzamide |
|---|---|
| PubChem CID | 66815493 |
| Molecular Formula | C27H33N3O |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | 4-[3,7-dimethyloct-6-enyl(methyl)amino]-N-quinolin-3-ylbenzamide |
| SMILES | CC(C)=CCCC(C)CCN(C)c1ccc(C(=O)Nc2cnc3ccccc3c2)cc1 |
| InChI | InChI=1S/C27H33N3O/c1-20(2)8-7-9-21(3)16-17-30(4)25-14-12-22(13-15-25)27(31)29-24-18-23-10-5-6-11-26(23)28-19-24/h5-6,8,10-15,18-19,21H,7,9,16-17H2,1-4H3,(H,29,31) |
| InChIKey | JCKOBZMMFMTVGL-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|