C23H23N3O — CID 66827351
1-pentan-2-yl-N-quinolin-3-ylindole-5-carboxamide (PubChem CID 66827351) has the molecular formula C23H23N3O and a molecular weight of 357.46 g/mol. Its IUPAC name is 1-pentan-2-yl-N-quinolin-3-ylindole-5-carboxamide.
| Compound Name | 1-pentan-2-yl-N-quinolin-3-ylindole-5-carboxamide |
|---|---|
| PubChem CID | 66827351 |
| Molecular Formula | C23H23N3O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 1-pentan-2-yl-N-quinolin-3-ylindole-5-carboxamide |
| SMILES | CCCC(C)n1ccc2cc(C(=O)Nc3cnc4ccccc4c3)ccc21 |
| InChI | InChI=1S/C23H23N3O/c1-3-6-16(2)26-12-11-18-13-19(9-10-22(18)26)23(27)25-20-14-17-7-4-5-8-21(17)24-15-20/h4-5,7-16H,3,6H2,1-2H3,(H,25,27) |
| InChIKey | FPWNJZNHBMVRPY-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |