C14H16FNO4 — CID 66815516
2-butan-2-yloxycarbonyl-3-(4-fluoroanilino)prop-2-enoic acid (PubChem CID 66815516) has the molecular formula C14H16FNO4 and a molecular weight of 281.28 g/mol. Its IUPAC name is 2-butan-2-yloxycarbonyl-3-(4-fluoroanilino)prop-2-enoic acid.
| Compound Name | 2-butan-2-yloxycarbonyl-3-(4-fluoroanilino)prop-2-enoic acid |
|---|---|
| PubChem CID | 66815516 |
| Molecular Formula | C14H16FNO4 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2-butan-2-yloxycarbonyl-3-(4-fluoroanilino)prop-2-enoic acid |
| SMILES | CCC(C)OC(=O)C(=CNc1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C14H16FNO4/c1-3-9(2)20-14(19)12(13(17)18)8-16-11-6-4-10(15)5-7-11/h4-9,16H,3H2,1-2H3,(H,17,18) |
| InChIKey | VMYIMJDMCUAHSQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|