C15H16ClNO5 — CID 173430603
2-butan-2-yloxycarbonyl-3-[(4-chloro-7-oxocyclohepta-1,3,5-trien-1-yl)amino]prop-2-enoic acid (PubChem CID 173430603) has the molecular formula C15H16ClNO5 and a molecular weight of 325.75 g/mol. Its IUPAC name is 2-butan-2-yloxycarbonyl-3-[(4-chloro-7-oxocyclohepta-1,3,5-trien-1-yl)amino]prop-2-enoic acid.
| Compound Name | 2-butan-2-yloxycarbonyl-3-[(4-chloro-7-oxocyclohepta-1,3,5-trien-1-yl)amino]prop-2-enoic acid |
|---|---|
| PubChem CID | 173430603 |
| Molecular Formula | C15H16ClNO5 |
| Molecular Weight | 325.75 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 2-butan-2-yloxycarbonyl-3-[(4-chloro-7-oxocyclohepta-1,3,5-trien-1-yl)amino]prop-2-enoic acid |
| SMILES | CCC(C)OC(=O)C(=CNc1ccc(Cl)ccc1=O)C(=O)O |
| InChI | InChI=1S/C15H16ClNO5/c1-3-9(2)22-15(21)11(14(19)20)8-17-12-6-4-10(16)5-7-13(12)18/h4-9H,3H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | AIJLETYOXUBANI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.75 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|