C28H31F4N3O6S — CID 66816141
8-[(E)-2-[4-(3,4-dihydroxybutoxy)-2,6-dimethylphenyl]ethenyl]sulfonyl-2-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 66816141) has the molecular formula C28H31F4N3O6S and a molecular weight of 613.63 g/mol. Its IUPAC name is 8-[(E)-2-[4-(3,4-dihydroxybutoxy)-2,6-dimethylphenyl]ethenyl]sulfonyl-2-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 8-[(E)-2-[4-(3,4-dihydroxybutoxy)-2,6-dimethylphenyl]ethenyl]sulfonyl-2-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 66816141 |
| Molecular Formula | C28H31F4N3O6S |
| Molecular Weight | 613.63 g/mol |
| Exact Mass | 613.19 |
| IUPAC Name | 8-[(E)-2-[4-(3,4-dihydroxybutoxy)-2,6-dimethylphenyl]ethenyl]sulfonyl-2-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | Cc1cc(OCCC(O)CO)cc(C)c1/C=C/S(=O)(=O)N1CCC2(CC1)N=C(c1ccc(F)c(C(F)(F)F)c1)NC2=O |
| InChI | InChI=1S/C28H31F4N3O6S/c1-17-13-21(41-11-5-20(37)16-36)14-18(2)22(17)6-12-42(39,40)35-9-7-27(8-10-35)26(38)33-25(34-27)19-3-4-24(29)23(15-19)28(30,31)32/h3-4,6,12-15,20,36-37H,5,7-11,16H2,1-2H3,(H,33,34,38)/b12-6+ |
| InChIKey | XRTXLPNKZWVMMC-WUXMJOGZSA-N |
| XLogP | 3.30 |
| TPSA | 128.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.63 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |