C28H36F3N5O5S — CID 66817931
3-[4-[(E)-2-[(2-nonyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl)sulfonyl]ethenyl]-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione (PubChem CID 66817931) has the molecular formula C28H36F3N5O5S and a molecular weight of 611.69 g/mol. Its IUPAC name is 3-[4-[(E)-2-[(2-nonyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl)sulfonyl]ethenyl]-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 3-[4-[(E)-2-[(2-nonyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl)sulfonyl]ethenyl]-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 66817931 |
| Molecular Formula | C28H36F3N5O5S |
| Molecular Weight | 611.69 g/mol |
| Exact Mass | 611.24 |
| IUPAC Name | 3-[4-[(E)-2-[(2-nonyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl)sulfonyl]ethenyl]-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
| SMILES | CCCCCCCCCC1=NC2(CCN(S(=O)(=O)/C=C/c3ccc(N4C(=O)CNC4=O)cc3C(F)(F)F)CC2)C(=O)N1 |
| InChI | InChI=1S/C28H36F3N5O5S/c1-2-3-4-5-6-7-8-9-23-33-25(38)27(34-23)13-15-35(16-14-27)42(40,41)17-12-20-10-11-21(18-22(20)28(29,30)31)36-24(37)19-32-26(36)39/h10-12,17-18H,2-9,13-16,19H2,1H3,(H,32,39)(H,33,34,38)/b17-12+ |
| InChIKey | GGKWPRXBCRBRCK-SFQUDFHCSA-N |
| XLogP | 4.57 |
| TPSA | 128.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.69 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|