C27H37F5N4O3S — CID 87166450
8-[(E)-2-[2,6-dimethyl-4-(methylamino)phenyl]ethenyl]sulfonyl-2-(8,8,9,9,9-pentafluorononyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 87166450) has the molecular formula C27H37F5N4O3S and a molecular weight of 592.68 g/mol. Its IUPAC name is 8-[(E)-2-[2,6-dimethyl-4-(methylamino)phenyl]ethenyl]sulfonyl-2-(8,8,9,9,9-pentafluorononyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 8-[(E)-2-[2,6-dimethyl-4-(methylamino)phenyl]ethenyl]sulfonyl-2-(8,8,9,9,9-pentafluorononyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 87166450 |
| Molecular Formula | C27H37F5N4O3S |
| Molecular Weight | 592.68 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | 8-[(E)-2-[2,6-dimethyl-4-(methylamino)phenyl]ethenyl]sulfonyl-2-(8,8,9,9,9-pentafluorononyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | CNc1cc(C)c(/C=C/S(=O)(=O)N2CCC3(CC2)N=C(CCCCCCCC(F)(F)C(F)(F)F)NC3=O)c(C)c1 |
| InChI | InChI=1S/C27H37F5N4O3S/c1-19-17-21(33-3)18-20(2)22(19)10-16-40(38,39)36-14-12-25(13-15-36)24(37)34-23(35-25)9-7-5-4-6-8-11-26(28,29)27(30,31)32/h10,16-18,33H,4-9,11-15H2,1-3H3,(H,34,35,37)/b16-10+ |
| InChIKey | XGYSNYQREFYUHN-MHWRWJLKSA-N |
| XLogP | 5.94 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.68 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|