C24H36N4O3S — CID 66818016
8-[2-[2,6-dimethyl-4-(methylamino)phenyl]ethylsulfonyl]-2-hex-5-enyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 66818016) has the molecular formula C24H36N4O3S and a molecular weight of 460.64 g/mol. Its IUPAC name is 8-[2-[2,6-dimethyl-4-(methylamino)phenyl]ethylsulfonyl]-2-hex-5-enyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 8-[2-[2,6-dimethyl-4-(methylamino)phenyl]ethylsulfonyl]-2-hex-5-enyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 66818016 |
| Molecular Formula | C24H36N4O3S |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 8-[2-[2,6-dimethyl-4-(methylamino)phenyl]ethylsulfonyl]-2-hex-5-enyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | C=CCCCCC1=NC2(CCN(S(=O)(=O)CCc3c(C)cc(NC)cc3C)CC2)C(=O)N1 |
| InChI | InChI=1S/C24H36N4O3S/c1-5-6-7-8-9-22-26-23(29)24(27-22)11-13-28(14-12-24)32(30,31)15-10-21-18(2)16-20(25-4)17-19(21)3/h5,16-17,25H,1,6-15H2,2-4H3,(H,26,27,29) |
| InChIKey | FLDMDXOCOVMOCR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|