C29H38N4O3S — CID 123652707
8-[2-[2,6-dimethyl-4-(methylamino)phenyl]ethenylsulfonyl]-2-(5-phenylpentyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 123652707) has the molecular formula C29H38N4O3S and a molecular weight of 522.72 g/mol. Its IUPAC name is 8-[2-[2,6-dimethyl-4-(methylamino)phenyl]ethenylsulfonyl]-2-(5-phenylpentyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 8-[2-[2,6-dimethyl-4-(methylamino)phenyl]ethenylsulfonyl]-2-(5-phenylpentyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 123652707 |
| Molecular Formula | C29H38N4O3S |
| Molecular Weight | 522.72 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | 8-[2-[2,6-dimethyl-4-(methylamino)phenyl]ethenylsulfonyl]-2-(5-phenylpentyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | CNc1cc(C)c(C=CS(=O)(=O)N2CCC3(CC2)N=C(CCCCCc2ccccc2)NC3=O)c(C)c1 |
| InChI | InChI=1S/C29H38N4O3S/c1-22-20-25(30-3)21-23(2)26(22)14-19-37(35,36)33-17-15-29(16-18-33)28(34)31-27(32-29)13-9-5-8-12-24-10-6-4-7-11-24/h4,6-7,10-11,14,19-21,30H,5,8-9,12-13,15-18H2,1-3H3,(H,31,32,34) |
| InChIKey | OIVOECQTYZICCD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.72 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|