C32H37F3N4O5S — CID 66818232
4-[2-[[2-[3-but-3-enoxy-5-(trifluoromethyl)phenyl]-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]-N,3-dimethyl-N-prop-2-enylbenzamide (PubChem CID 66818232) has the molecular formula C32H37F3N4O5S and a molecular weight of 646.73 g/mol. Its IUPAC name is 4-[2-[[2-[3-but-3-enoxy-5-(trifluoromethyl)phenyl]-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]-N,3-dimethyl-N-prop-2-enylbenzamide.
| Compound Name | 4-[2-[[2-[3-but-3-enoxy-5-(trifluoromethyl)phenyl]-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]-N,3-dimethyl-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 66818232 |
| Molecular Formula | C32H37F3N4O5S |
| Molecular Weight | 646.73 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | 4-[2-[[2-[3-but-3-enoxy-5-(trifluoromethyl)phenyl]-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]-N,3-dimethyl-N-prop-2-enylbenzamide |
| SMILES | C=CCCOc1cc(C2=NC3(CCN(S(=O)(=O)CCc4ccc(C(=O)N(C)CC=C)cc4C)CC3)C(=O)N2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H37F3N4O5S/c1-5-7-16-44-27-20-25(19-26(21-27)32(33,34)35)28-36-30(41)31(37-28)11-14-39(15-12-31)45(42,43)17-10-23-8-9-24(18-22(23)3)29(40)38(4)13-6-2/h5-6,8-9,18-21H,1-2,7,10-17H2,3-4H3,(H,36,37,41) |
| InChIKey | MNEYSPPIEPXJPJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.73 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|