C35H43F3N4O5S — CID 66817796
4-[2-[[2-[3-but-3-enoxy-5-(trifluoromethyl)phenyl]-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]-N-hex-5-enyl-N,3-dimethylbenzamide (PubChem CID 66817796) has the molecular formula C35H43F3N4O5S and a molecular weight of 688.81 g/mol. Its IUPAC name is 4-[2-[[2-[3-but-3-enoxy-5-(trifluoromethyl)phenyl]-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]-N-hex-5-enyl-N,3-dimethylbenzamide.
| Compound Name | 4-[2-[[2-[3-but-3-enoxy-5-(trifluoromethyl)phenyl]-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]-N-hex-5-enyl-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 66817796 |
| Molecular Formula | C35H43F3N4O5S |
| Molecular Weight | 688.81 g/mol |
| Exact Mass | 688.29 |
| IUPAC Name | 4-[2-[[2-[3-but-3-enoxy-5-(trifluoromethyl)phenyl]-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]-N-hex-5-enyl-N,3-dimethylbenzamide |
| SMILES | C=CCCCCN(C)C(=O)c1ccc(CCS(=O)(=O)N2CCC3(CC2)N=C(c2cc(OCCC=C)cc(C(F)(F)F)c2)NC3=O)c(C)c1 |
| InChI | InChI=1S/C35H43F3N4O5S/c1-5-7-9-10-16-41(4)32(43)27-12-11-26(25(3)21-27)13-20-48(45,46)42-17-14-34(15-18-42)33(44)39-31(40-34)28-22-29(35(36,37)38)24-30(23-28)47-19-8-6-2/h5-6,11-12,21-24H,1-2,7-10,13-20H2,3-4H3,(H,39,40,44) |
| InChIKey | AGBXVOVSURGVKB-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.81 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|