C31H47N5O3 — CID 66818867
tert-butyl 2-[2-[[4-(8-cyclooctyl-8-azabicyclo[3.2.1]octan-3-yl)-3-oxoquinoxalin-2-yl]amino]ethylamino]acetate (PubChem CID 66818867) has the molecular formula C31H47N5O3 and a molecular weight of 537.75 g/mol. Its IUPAC name is tert-butyl 2-[2-[[4-(8-cyclooctyl-8-azabicyclo[3.2.1]octan-3-yl)-3-oxoquinoxalin-2-yl]amino]ethylamino]acetate.
| Compound Name | tert-butyl 2-[2-[[4-(8-cyclooctyl-8-azabicyclo[3.2.1]octan-3-yl)-3-oxoquinoxalin-2-yl]amino]ethylamino]acetate |
|---|---|
| PubChem CID | 66818867 |
| Molecular Formula | C31H47N5O3 |
| Molecular Weight | 537.75 g/mol |
| Exact Mass | 537.37 |
| IUPAC Name | tert-butyl 2-[2-[[4-(8-cyclooctyl-8-azabicyclo[3.2.1]octan-3-yl)-3-oxoquinoxalin-2-yl]amino]ethylamino]acetate |
| SMILES | CC(C)(C)OC(=O)CNCCNc1nc2ccccc2n(C2CC3CCC(C2)N3C2CCCCCCC2)c1=O |
| InChI | InChI=1S/C31H47N5O3/c1-31(2,3)39-28(37)21-32-17-18-33-29-30(38)36(27-14-10-9-13-26(27)34-29)25-19-23-15-16-24(20-25)35(23)22-11-7-5-4-6-8-12-22/h9-10,13-14,22-25,32H,4-8,11-12,15-21H2,1-3H3,(H,33,34) |
| InChIKey | RTTPSFGIZPOMQE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.75 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|