C26H38N4O3 — CID 59450939
ethyl 3-[[4-(1-cyclooctylpiperidin-4-yl)-3-oxoquinoxalin-2-yl]amino]propanoate (PubChem CID 59450939) has the molecular formula C26H38N4O3 and a molecular weight of 454.62 g/mol. Its IUPAC name is ethyl 3-[[4-(1-cyclooctylpiperidin-4-yl)-3-oxoquinoxalin-2-yl]amino]propanoate.
| Compound Name | ethyl 3-[[4-(1-cyclooctylpiperidin-4-yl)-3-oxoquinoxalin-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 59450939 |
| Molecular Formula | C26H38N4O3 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | ethyl 3-[[4-(1-cyclooctylpiperidin-4-yl)-3-oxoquinoxalin-2-yl]amino]propanoate |
| SMILES | CCOC(=O)CCNc1nc2ccccc2n(C2CCN(C3CCCCCCC3)CC2)c1=O |
| InChI | InChI=1S/C26H38N4O3/c1-2-33-24(31)14-17-27-25-26(32)30(23-13-9-8-12-22(23)28-25)21-15-18-29(19-16-21)20-10-6-4-3-5-7-11-20/h8-9,12-13,20-21H,2-7,10-11,14-19H2,1H3,(H,27,28) |
| InChIKey | MBPGHRSQRRNSJR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |