C26H37N3O3 — CID 159717370
4-[4-(1-cyclooctylpiperidin-4-yl)-3-oxoquinoxalin-2-yl]-3-methylbutanoic acid (PubChem CID 159717370) has the molecular formula C26H37N3O3 and a molecular weight of 439.60 g/mol. Its IUPAC name is 4-[4-(1-cyclooctylpiperidin-4-yl)-3-oxoquinoxalin-2-yl]-3-methylbutanoic acid.
| Compound Name | 4-[4-(1-cyclooctylpiperidin-4-yl)-3-oxoquinoxalin-2-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 159717370 |
| Molecular Formula | C26H37N3O3 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | 4-[4-(1-cyclooctylpiperidin-4-yl)-3-oxoquinoxalin-2-yl]-3-methylbutanoic acid |
| SMILES | CC(CC(=O)O)Cc1nc2ccccc2n(C2CCN(C3CCCCCCC3)CC2)c1=O |
| InChI | InChI=1S/C26H37N3O3/c1-19(18-25(30)31)17-23-26(32)29(24-12-8-7-11-22(24)27-23)21-13-15-28(16-14-21)20-9-5-3-2-4-6-10-20/h7-8,11-12,19-21H,2-6,9-10,13-18H2,1H3,(H,30,31) |
| InChIKey | YTUOKRXZPXTLJG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |