C29H39N5O4 — CID 59450898
2-[2-[4-(1-cyclooctylpiperidin-4-yl)-3-oxoquinoxalin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-oxoacetic acid (PubChem CID 59450898) has the molecular formula C29H39N5O4 and a molecular weight of 521.66 g/mol. Its IUPAC name is 2-[2-[4-(1-cyclooctylpiperidin-4-yl)-3-oxoquinoxalin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-oxoacetic acid.
| Compound Name | 2-[2-[4-(1-cyclooctylpiperidin-4-yl)-3-oxoquinoxalin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 59450898 |
| Molecular Formula | C29H39N5O4 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | 2-[2-[4-(1-cyclooctylpiperidin-4-yl)-3-oxoquinoxalin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)N1CC2CN(c3nc4ccccc4n(C4CCN(C5CCCCCCC5)CC4)c3=O)CC2C1 |
| InChI | InChI=1S/C29H39N5O4/c35-27-26(32-16-20-18-33(19-21(20)17-32)28(36)29(37)38)30-24-10-6-7-11-25(24)34(27)23-12-14-31(15-13-23)22-8-4-2-1-3-5-9-22/h6-7,10-11,20-23H,1-5,8-9,12-19H2,(H,37,38) |
| InChIKey | FIBLLLAUGKSSSB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|