C25H35N5O — CID 163455019
1-(1-cyclooctylpiperidin-4-yl)-3-(3-iminopyrrolidin-1-yl)quinoxalin-2-one (PubChem CID 163455019) has the molecular formula C25H35N5O and a molecular weight of 421.59 g/mol. Its IUPAC name is 1-(1-cyclooctylpiperidin-4-yl)-3-(3-iminopyrrolidin-1-yl)quinoxalin-2-one.
| Compound Name | 1-(1-cyclooctylpiperidin-4-yl)-3-(3-iminopyrrolidin-1-yl)quinoxalin-2-one |
|---|---|
| PubChem CID | 163455019 |
| Molecular Formula | C25H35N5O |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | 1-(1-cyclooctylpiperidin-4-yl)-3-(3-iminopyrrolidin-1-yl)quinoxalin-2-one |
| SMILES | [H]/N=C1\CCN(c2nc3ccccc3n(C3CCN(C4CCCCCCC4)CC3)c2=O)C1 |
| InChI | InChI=1S/C25H35N5O/c26-19-12-15-29(18-19)24-25(31)30(23-11-7-6-10-22(23)27-24)21-13-16-28(17-14-21)20-8-4-2-1-3-5-9-20/h6-7,10-11,20-21,26H,1-5,8-9,12-18H2/b26-19+ |
| InChIKey | BJRSWNWMQURDRM-LGUFXXKBSA-N |
| XLogP | 4.38 |
| TPSA | 65.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|