C40H53N5O5 — CID 146238981
tert-butyl 2-[3-oxo-4-[1-(1-phenylmethoxycarbonylcyclooctyl)piperidin-4-yl]quinoxalin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 146238981) has the molecular formula C40H53N5O5 and a molecular weight of 683.89 g/mol. Its IUPAC name is tert-butyl 2-[3-oxo-4-[1-(1-phenylmethoxycarbonylcyclooctyl)piperidin-4-yl]quinoxalin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl 2-[3-oxo-4-[1-(1-phenylmethoxycarbonylcyclooctyl)piperidin-4-yl]quinoxalin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 146238981 |
| Molecular Formula | C40H53N5O5 |
| Molecular Weight | 683.89 g/mol |
| Exact Mass | 683.40 |
| IUPAC Name | tert-butyl 2-[3-oxo-4-[1-(1-phenylmethoxycarbonylcyclooctyl)piperidin-4-yl]quinoxalin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CN(c3nc4ccccc4n(C4CCN(C5(C(=O)OCc6ccccc6)CCCCCCC5)CC4)c3=O)CC2C1 |
| InChI | InChI=1S/C40H53N5O5/c1-39(2,3)50-38(48)43-26-30-24-42(25-31(30)27-43)35-36(46)45(34-17-11-10-16-33(34)41-35)32-18-22-44(23-19-32)40(20-12-5-4-6-13-21-40)37(47)49-28-29-14-8-7-9-15-29/h7-11,14-17,30-32H,4-6,12-13,18-28H2,1-3H3 |
| InChIKey | LBHYQZCBDOJBIG-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 97.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.89 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |