C25H29N3O4 — CID 59063194
tert-butyl 2-[(2S)-2-phenylmethoxycarbonylpiperidin-1-yl]benzimidazole-1-carboxylate (PubChem CID 59063194) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is tert-butyl 2-[(2S)-2-phenylmethoxycarbonylpiperidin-1-yl]benzimidazole-1-carboxylate.
| Compound Name | tert-butyl 2-[(2S)-2-phenylmethoxycarbonylpiperidin-1-yl]benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 59063194 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | tert-butyl 2-[(2S)-2-phenylmethoxycarbonylpiperidin-1-yl]benzimidazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(N2CCCC[C@H]2C(=O)OCc2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C25H29N3O4/c1-25(2,3)32-24(30)28-20-14-8-7-13-19(20)26-23(28)27-16-10-9-15-21(27)22(29)31-17-18-11-5-4-6-12-18/h4-8,11-14,21H,9-10,15-17H2,1-3H3/t21-/m0/s1 |
| InChIKey | NJEFYMIIQQPDJB-NRFANRHFSA-N |
| XLogP | 4.92 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |