C27H35N5O2 — CID 66827852
1-(1-cyclooctylpiperidin-4-yl)-3-[(6-methoxy-3-pyridinyl)amino]quinoxalin-2-one (PubChem CID 66827852) has the molecular formula C27H35N5O2 and a molecular weight of 461.61 g/mol. Its IUPAC name is 1-(1-cyclooctylpiperidin-4-yl)-3-[(6-methoxy-3-pyridinyl)amino]quinoxalin-2-one.
| Compound Name | 1-(1-cyclooctylpiperidin-4-yl)-3-[(6-methoxy-3-pyridinyl)amino]quinoxalin-2-one |
|---|---|
| PubChem CID | 66827852 |
| Molecular Formula | C27H35N5O2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | 1-(1-cyclooctylpiperidin-4-yl)-3-[(6-methoxy-3-pyridinyl)amino]quinoxalin-2-one |
| SMILES | COc1ccc(Nc2nc3ccccc3n(C3CCN(C4CCCCCCC4)CC3)c2=O)cn1 |
| InChI | InChI=1S/C27H35N5O2/c1-34-25-14-13-20(19-28-25)29-26-27(33)32(24-12-8-7-11-23(24)30-26)22-15-17-31(18-16-22)21-9-5-3-2-4-6-10-21/h7-8,11-14,19,21-22H,2-6,9-10,15-18H2,1H3,(H,29,30) |
| InChIKey | PKHQCKPNCMWYHX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |