C11H17F3N4O2 — CID 66819353
5-pentylpyrimidine-2,4-diamine;2,2,2-trifluoroacetic acid (PubChem CID 66819353) has the molecular formula C11H17F3N4O2 and a molecular weight of 294.28 g/mol. Its IUPAC name is 5-pentylpyrimidine-2,4-diamine;2,2,2-trifluoroacetic acid.
| Compound Name | 5-pentylpyrimidine-2,4-diamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66819353 |
| Molecular Formula | C11H17F3N4O2 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 5-pentylpyrimidine-2,4-diamine;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCc1cnc(N)nc1N.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H16N4.C2HF3O2/c1-2-3-4-5-7-6-12-9(11)13-8(7)10;3-2(4,5)1(6)7/h6H,2-5H2,1H3,(H4,10,11,12,13);(H,6,7) |
| InChIKey | ALFYWRFIGVWDSG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|