C8H4F2O2 — CID 66820048
4,5-difluoro-3H-2-benzofuran-1-one (PubChem CID 66820048) has the molecular formula C8H4F2O2 and a molecular weight of 170.11 g/mol. Its IUPAC name is 4,5-difluoro-3H-2-benzofuran-1-one.
| Compound Name | 4,5-difluoro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 66820048 |
| Molecular Formula | C8H4F2O2 |
| Molecular Weight | 170.11 g/mol |
| Exact Mass | 170.02 |
| IUPAC Name | 4,5-difluoro-3H-2-benzofuran-1-one |
| SMILES | O=C1OCc2c1ccc(F)c2F |
| InChI | InChI=1S/C8H4F2O2/c9-6-2-1-4-5(7(6)10)3-12-8(4)11/h1-2H,3H2 |
| InChIKey | ZYZVOVYVLBQGMH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.11 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |