C10H6F2O3 — CID 67483015
4-(2,3-difluorophenyl)-3-hydroxy-2H-furan-5-one (PubChem CID 67483015) has the molecular formula C10H6F2O3 and a molecular weight of 212.15 g/mol. Its IUPAC name is 4-(2,3-difluorophenyl)-3-hydroxy-2H-furan-5-one.
| Compound Name | 4-(2,3-difluorophenyl)-3-hydroxy-2H-furan-5-one |
|---|---|
| PubChem CID | 67483015 |
| Molecular Formula | C10H6F2O3 |
| Molecular Weight | 212.15 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 4-(2,3-difluorophenyl)-3-hydroxy-2H-furan-5-one |
| SMILES | O=C1OCC(O)=C1c1cccc(F)c1F |
| InChI | InChI=1S/C10H6F2O3/c11-6-3-1-2-5(9(6)12)8-7(13)4-15-10(8)14/h1-3,13H,4H2 |
| InChIKey | DSYFVTRTXMMCOS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.15 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |