C11H21IN2O3 — CID 66820432
4-(aminomethyl)-2-tert-butyl-3-hydroxy-2-iodopiperidine-1-carboxylic acid (PubChem CID 66820432) has the molecular formula C11H21IN2O3 and a molecular weight of 356.20 g/mol. Its IUPAC name is 4-(aminomethyl)-2-tert-butyl-3-hydroxy-2-iodopiperidine-1-carboxylic acid.
| Compound Name | 4-(aminomethyl)-2-tert-butyl-3-hydroxy-2-iodopiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 66820432 |
| Molecular Formula | C11H21IN2O3 |
| Molecular Weight | 356.20 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 4-(aminomethyl)-2-tert-butyl-3-hydroxy-2-iodopiperidine-1-carboxylic acid |
| SMILES | CC(C)(C)C1(I)C(O)C(CN)CCN1C(=O)O |
| InChI | InChI=1S/C11H21IN2O3/c1-10(2,3)11(12)8(15)7(6-13)4-5-14(11)9(16)17/h7-8,15H,4-6,13H2,1-3H3,(H,16,17) |
| InChIKey | HWMTVOSALVTURT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|