C14H22F2O2 — CID 66827594
butyl 4-[(E)-3,3-difluoroprop-1-enyl]cyclohexane-1-carboxylate (PubChem CID 66827594) has the molecular formula C14H22F2O2 and a molecular weight of 260.32 g/mol. Its IUPAC name is butyl 4-[(E)-3,3-difluoroprop-1-enyl]cyclohexane-1-carboxylate.
| Compound Name | butyl 4-[(E)-3,3-difluoroprop-1-enyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 66827594 |
| Molecular Formula | C14H22F2O2 |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | butyl 4-[(E)-3,3-difluoroprop-1-enyl]cyclohexane-1-carboxylate |
| SMILES | CCCCOC(=O)C1CCC(/C=C/C(F)F)CC1 |
| InChI | InChI=1S/C14H22F2O2/c1-2-3-10-18-14(17)12-7-4-11(5-8-12)6-9-13(15)16/h6,9,11-13H,2-5,7-8,10H2,1H3/b9-6+ |
| InChIKey | BJMYBWIIUVAWCL-RMKNXTFCSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|