C6H5F3 — CID 66828021
1,2,6-trifluorocyclohexa-1,3-diene (PubChem CID 66828021) has the molecular formula C6H5F3 and a molecular weight of 134.10 g/mol. Its IUPAC name is 1,2,6-trifluorocyclohexa-1,3-diene.
| Compound Name | 1,2,6-trifluorocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 66828021 |
| Molecular Formula | C6H5F3 |
| Molecular Weight | 134.10 g/mol |
| Exact Mass | 134.03 |
| IUPAC Name | 1,2,6-trifluorocyclohexa-1,3-diene |
| SMILES | FC1=C(F)C(F)CC=C1 |
| InChI | InChI=1S/C6H5F3/c7-4-2-1-3-5(8)6(4)9/h1-2,5H,3H2 |
| InChIKey | NAGJUWFGDVFWAN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.10 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |