C24H26ClN7S — CID 66828186
N-[[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]methyl]-3-(1H-imidazol-2-yl)propan-1-amine (PubChem CID 66828186) has the molecular formula C24H26ClN7S and a molecular weight of 480.04 g/mol. Its IUPAC name is N-[[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]methyl]-3-(1H-imidazol-2-yl)propan-1-amine.
| Compound Name | N-[[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]methyl]-3-(1H-imidazol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 66828186 |
| Molecular Formula | C24H26ClN7S |
| Molecular Weight | 480.04 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | N-[[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]methyl]-3-(1H-imidazol-2-yl)propan-1-amine |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CNCCCc1ncc[nH]1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C24H26ClN7S/c1-14-15(2)33-24-21(14)22(17-6-8-18(25)9-7-17)29-19(23-31-30-16(3)32(23)24)13-26-10-4-5-20-27-11-12-28-20/h6-9,11-12,19,26H,4-5,10,13H2,1-3H3,(H,27,28)/t19-/m0/s1 |
| InChIKey | HRZUVSWFKFIGAV-IBGZPJMESA-N |
| XLogP | 4.75 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.04 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|