C23H21ClN8OS — CID 137154956
2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-[(Z)-1H-imidazol-2-ylmethylideneamino]acetamide (PubChem CID 137154956) has the molecular formula C23H21ClN8OS and a molecular weight of 493.00 g/mol. Its IUPAC name is 2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-[(Z)-1H-imidazol-2-ylmethylideneamino]acetamide.
| Compound Name | 2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-[(Z)-1H-imidazol-2-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 137154956 |
| Molecular Formula | C23H21ClN8OS |
| Molecular Weight | 493.00 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-[(Z)-1H-imidazol-2-ylmethylideneamino]acetamide |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)N/N=C\c1ncc[nH]1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C23H21ClN8OS/c1-12-13(2)34-23-20(12)21(15-4-6-16(24)7-5-15)28-17(22-31-29-14(3)32(22)23)10-19(33)30-27-11-18-25-8-9-26-18/h4-9,11,17H,10H2,1-3H3,(H,25,26)(H,30,33)/b27-11-/t17-/m0/s1 |
| InChIKey | REQSRCJXMTYUJG-ORSZLXNWSA-N |
| XLogP | 4.06 |
| TPSA | 113.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.00 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|