C26H22ClIN6O2S — CID 155332564
[4-[(E)-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]hydrazinylidene]methyl]phenyl] hypoiodite (PubChem CID 155332564) has the molecular formula C26H22ClIN6O2S and a molecular weight of 644.93 g/mol. Its IUPAC name is [4-[(E)-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]hydrazinylidene]methyl]phenyl] hypoiodite.
| Compound Name | [4-[(E)-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]hydrazinylidene]methyl]phenyl] hypoiodite |
|---|---|
| PubChem CID | 155332564 |
| Molecular Formula | C26H22ClIN6O2S |
| Molecular Weight | 644.93 g/mol |
| Exact Mass | 644.03 |
| IUPAC Name | [4-[(E)-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]hydrazinylidene]methyl]phenyl] hypoiodite |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)N/N=C/c1ccc(OI)cc1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C26H22ClIN6O2S/c1-14-15(2)37-26-23(14)24(18-6-8-19(27)9-7-18)30-21(25-33-31-16(3)34(25)26)12-22(35)32-29-13-17-4-10-20(36-28)11-5-17/h4-11,13,21H,12H2,1-3H3,(H,32,35)/b29-13+/t21-/m0/s1 |
| InChIKey | CDQZMDKIEXPFTH-KMWLTISVSA-N |
| XLogP | 6.07 |
| TPSA | 93.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.93 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|