C24H22ClN7O2S — CID 172955428
2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-[(E)-(5-methyl-1,3-oxazol-2-yl)methylideneamino]acetamide (PubChem CID 172955428) has the molecular formula C24H22ClN7O2S and a molecular weight of 508.01 g/mol. Its IUPAC name is 2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-[(E)-(5-methyl-1,3-oxazol-2-yl)methylideneamino]acetamide.
| Compound Name | 2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-[(E)-(5-methyl-1,3-oxazol-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 172955428 |
| Molecular Formula | C24H22ClN7O2S |
| Molecular Weight | 508.01 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | 2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-[(E)-(5-methyl-1,3-oxazol-2-yl)methylideneamino]acetamide |
| SMILES | Cc1cnc(/C=N/NC(=O)C[C@@H]2N=C(c3ccc(Cl)cc3)c3c(sc(C)c3C)-n3c(C)nnc32)o1 |
| InChI | InChI=1S/C24H22ClN7O2S/c1-12-10-26-20(34-12)11-27-30-19(33)9-18-23-31-29-15(4)32(23)24-21(13(2)14(3)35-24)22(28-18)16-5-7-17(25)8-6-16/h5-8,10-11,18H,9H2,1-4H3,(H,30,33)/b27-11+/t18-/m0/s1 |
| InChIKey | KFWIYVVIDWVIMQ-NPLHSSQESA-N |
| XLogP | 4.64 |
| TPSA | 110.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.01 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|