C25H30ClN7O3 — CID 66830198
(1S,2S,3R,4R)-3-[[2-[(3-amino-1-ethyl-6-methoxy-2-oxo-4,5-dihydro-3H-1-benzazepin-7-yl)amino]-5-chloropyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 66830198) has the molecular formula C25H30ClN7O3 and a molecular weight of 512.01 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-[[2-[(3-amino-1-ethyl-6-methoxy-2-oxo-4,5-dihydro-3H-1-benzazepin-7-yl)amino]-5-chloropyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,2S,3R,4R)-3-[[2-[(3-amino-1-ethyl-6-methoxy-2-oxo-4,5-dihydro-3H-1-benzazepin-7-yl)amino]-5-chloropyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 66830198 |
| Molecular Formula | C25H30ClN7O3 |
| Molecular Weight | 512.01 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | (1S,2S,3R,4R)-3-[[2-[(3-amino-1-ethyl-6-methoxy-2-oxo-4,5-dihydro-3H-1-benzazepin-7-yl)amino]-5-chloropyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CCN1C(=O)C(N)CCc2c1ccc(Nc1ncc(Cl)c(N[C@H]3[C@@H](C(N)=O)[C@@H]4C=C[C@H]3C4)n1)c2OC |
| InChI | InChI=1S/C25H30ClN7O3/c1-3-33-18-9-8-17(21(36-2)14(18)6-7-16(27)24(33)35)30-25-29-11-15(26)23(32-25)31-20-13-5-4-12(10-13)19(20)22(28)34/h4-5,8-9,11-13,16,19-20H,3,6-7,10,27H2,1-2H3,(H2,28,34)(H2,29,30,31,32)/t12-,13+,16?,19+,20-/m1/s1 |
| InChIKey | DTSVTLZFHOTSSR-MNIIQNBQSA-N |
| XLogP | 2.60 |
| TPSA | 148.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.01 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|