C23H25ClN6O3 — CID 67263929
(1R,2R,3S,4S)-3-[[5-chloro-2-[(6-methoxy-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 67263929) has the molecular formula C23H25ClN6O3 and a molecular weight of 468.95 g/mol. Its IUPAC name is (1R,2R,3S,4S)-3-[[5-chloro-2-[(6-methoxy-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2R,3S,4S)-3-[[5-chloro-2-[(6-methoxy-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 67263929 |
| Molecular Formula | C23H25ClN6O3 |
| Molecular Weight | 468.95 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | (1R,2R,3S,4S)-3-[[5-chloro-2-[(6-methoxy-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | COc1c(Nc2ncc(Cl)c(N[C@@H]3[C@H](C(N)=O)[C@H]4C=C[C@@H]3C4)n2)ccc2c1CCCC(=O)N2 |
| InChI | InChI=1S/C23H25ClN6O3/c1-33-20-13-3-2-4-17(31)27-15(13)7-8-16(20)28-23-26-10-14(24)22(30-23)29-19-12-6-5-11(9-12)18(19)21(25)32/h5-8,10-12,18-19H,2-4,9H2,1H3,(H2,25,32)(H,27,31)(H2,26,28,29,30)/t11-,12+,18+,19-/m0/s1 |
| InChIKey | HTSATKVAACRDID-FUIXPZOKSA-N |
| XLogP | 3.24 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.95 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|