C22H24ClN5O3 — CID 66831685
4-[(5-chloro-2-pyridinyl)methoxy]-1-[6-[2-(cyclobutylamino)ethylamino]-2-oxo-1H-pyridin-3-yl]pyridin-2-one (PubChem CID 66831685) has the molecular formula C22H24ClN5O3 and a molecular weight of 441.92 g/mol. Its IUPAC name is 4-[(5-chloro-2-pyridinyl)methoxy]-1-[6-[2-(cyclobutylamino)ethylamino]-2-oxo-1H-pyridin-3-yl]pyridin-2-one.
| Compound Name | 4-[(5-chloro-2-pyridinyl)methoxy]-1-[6-[2-(cyclobutylamino)ethylamino]-2-oxo-1H-pyridin-3-yl]pyridin-2-one |
|---|---|
| PubChem CID | 66831685 |
| Molecular Formula | C22H24ClN5O3 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 4-[(5-chloro-2-pyridinyl)methoxy]-1-[6-[2-(cyclobutylamino)ethylamino]-2-oxo-1H-pyridin-3-yl]pyridin-2-one |
| SMILES | O=c1[nH]c(NCCNC2CCC2)ccc1-n1ccc(OCc2ccc(Cl)cn2)cc1=O |
| InChI | InChI=1S/C22H24ClN5O3/c23-15-4-5-17(26-13-15)14-31-18-8-11-28(21(29)12-18)19-6-7-20(27-22(19)30)25-10-9-24-16-2-1-3-16/h4-8,11-13,16,24H,1-3,9-10,14H2,(H2,25,27,30) |
| InChIKey | POVLECYDQLUPPC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 101.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|