C24H28ClN5O4 — CID 66831739
4-[(5-chloro-2-pyridinyl)methoxy]-1-[6-[3-(oxan-4-ylamino)propylamino]-2-oxo-1H-pyridin-3-yl]pyridin-2-one (PubChem CID 66831739) has the molecular formula C24H28ClN5O4 and a molecular weight of 485.97 g/mol. Its IUPAC name is 4-[(5-chloro-2-pyridinyl)methoxy]-1-[6-[3-(oxan-4-ylamino)propylamino]-2-oxo-1H-pyridin-3-yl]pyridin-2-one.
| Compound Name | 4-[(5-chloro-2-pyridinyl)methoxy]-1-[6-[3-(oxan-4-ylamino)propylamino]-2-oxo-1H-pyridin-3-yl]pyridin-2-one |
|---|---|
| PubChem CID | 66831739 |
| Molecular Formula | C24H28ClN5O4 |
| Molecular Weight | 485.97 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 4-[(5-chloro-2-pyridinyl)methoxy]-1-[6-[3-(oxan-4-ylamino)propylamino]-2-oxo-1H-pyridin-3-yl]pyridin-2-one |
| SMILES | O=c1[nH]c(NCCCNC2CCOCC2)ccc1-n1ccc(OCc2ccc(Cl)cn2)cc1=O |
| InChI | InChI=1S/C24H28ClN5O4/c25-17-2-3-19(28-15-17)16-34-20-6-11-30(23(31)14-20)21-4-5-22(29-24(21)32)27-10-1-9-26-18-7-12-33-13-8-18/h2-6,11,14-15,18,26H,1,7-10,12-13,16H2,(H2,27,29,32) |
| InChIKey | KBGLHRJYCPEBGH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.97 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|