C21H18Cl2FN3O2 — CID 66832086
1-(4-chloro-3-fluorophenyl)-N-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-oxopyrrolidine-3-carboxamide (PubChem CID 66832086) has the molecular formula C21H18Cl2FN3O2 and a molecular weight of 434.30 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-N-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-N-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 66832086 |
| Molecular Formula | C21H18Cl2FN3O2 |
| Molecular Weight | 434.30 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-N-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCCc1c[nH]c2ccc(Cl)cc12)C1CCN(c2ccc(Cl)c(F)c2)C1=O |
| InChI | InChI=1S/C21H18Cl2FN3O2/c22-13-1-4-19-16(9-13)12(11-26-19)5-7-25-20(28)15-6-8-27(21(15)29)14-2-3-17(23)18(24)10-14/h1-4,9-11,15,26H,5-8H2,(H,25,28) |
| InChIKey | HHDSXPFBRILDEP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.30 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|